Products 864431-36-7

CAS 864431-36-7 is the registry number for SBI-0087702, 99.55%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 5 mg, 10 mg, 100 mg.

Structural formula: {0} (CAS {1})

N-[(4-methoxynaphthalen-1-yl)methyl]-2-(4-methoxyphenyl)ethanamine (CAS 864431-36-7) is a chemical compound with the molecular formula C21H23NO2 and a molecular weight of 321.4 g/mol. IUPAC name: N-[(4-methoxynaphthalen-1-yl)methyl]-2-(4-methoxyphenyl)ethanamine. InChIKey: SNBZXHDTILHVJS-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO2
Molecular weight321.4 g/mol
IUPAC nameN-[(4-methoxynaphthalen-1-yl)methyl]-2-(4-methoxyphenyl)ethanamine
InChIKeySNBZXHDTILHVJS-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CCNCC2=CC=C(C3=CC=CC=C23)OC

Computed by PubChem (NCBI)

Synonyms: orb2945823