CAS 864516-77-8 is the registry number for NAP1051. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (E,5S,6R)-5,6-dihydroxy-8-[3-[(E,3R)-3-hydroxyoct-1-enyl]phenyl]oct-7-enoate (CAS 864516-77-8) is a chemical compound with the molecular formula C23H34O5 and a molecular weight of 390.5 g/mol. IUPAC name: methyl (E,5S,6R)-5,6-dihydroxy-8-[3-[(E,3R)-3-hydroxyoct-1-enyl]phenyl]oct-7-enoate. InChIKey: BGMWMUFLETWNBH-QMHAZQIESA-N.
| Molecular formula | C23H34O5 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | methyl (E,5S,6R)-5,6-dihydroxy-8-[3-[(E,3R)-3-hydroxyoct-1-enyl]phenyl]oct-7-enoate |
| InChIKey | BGMWMUFLETWNBH-QMHAZQIESA-N |
| SMILES | CCCCC[C@H](/C=C/C1=CC(=CC=C1)/C=C/[C@H]([C@H](CCCC(=O)OC)O)O)O |
Computed by PubChem (NCBI)