Products 864754-39-2
CAS 864754-39-2 is the registry number for (R)-1-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol (CAS 864754-39-2) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: (1R)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol. InChIKey: ZKBUTGMEHBYFRA-SNVBAGLBSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | (1R)-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanol |
| InChIKey | ZKBUTGMEHBYFRA-SNVBAGLBSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)[C@@H](C)O |
Computed by PubChem (NCBI)