Products 1357000-38-4

CAS 1357000-38-4 appears in our catalog under these names: 2-(Phenoxy)ethylboronic acid pinacol ester, 95%, 4,4,5,5-Tetramethyl-2-(2-phenoxyethyl)-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

4,4,5,5-tetramethyl-2-(2-phenoxyethyl)-1,3,2-dioxaborolane (CAS 1357000-38-4) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-phenoxyethyl)-1,3,2-dioxaborolane. InChIKey: KZMFRJSOVZZSER-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21BO3
Molecular weight248.13 g/mol
IUPAC name4,4,5,5-tetramethyl-2-(2-phenoxyethyl)-1,3,2-dioxaborolane
InChIKeyKZMFRJSOVZZSER-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)CCOC2=CC=CC=C2

Computed by PubChem (NCBI)