Products 864763-60-0
CAS 864763-60-0 is the registry number for Gnetucleistol B. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
5-[(E)-2-(2,6-dihydroxyphenyl)ethenyl]-2-methoxybenzene-1,3-diol (CAS 864763-60-0) is a chemical compound with the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. IUPAC name: 5-[(E)-2-(2,6-dihydroxyphenyl)ethenyl]-2-methoxybenzene-1,3-diol. InChIKey: JLTRDKZCEOBVNB-AATRIKPKSA-N.
| Molecular formula | C15H14O5 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | 5-[(E)-2-(2,6-dihydroxyphenyl)ethenyl]-2-methoxybenzene-1,3-diol |
| InChIKey | JLTRDKZCEOBVNB-AATRIKPKSA-N |
| SMILES | COC1=C(C=C(C=C1O)/C=C/C2=C(C=CC=C2O)O)O |
Computed by PubChem (NCBI)