Products 864774-69-6
CAS 864774-69-6 is the registry number for 3-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
3-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole (CAS 864774-69-6) is a chemical compound with the molecular formula C15H21BN2O2 and a molecular weight of 272.15 g/mol. IUPAC name: 3-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole. InChIKey: QTQOMKBLCGMCNK-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O2 |
|---|---|
| Molecular weight | 272.15 g/mol |
| IUPAC name | 3-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole |
| InChIKey | QTQOMKBLCGMCNK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(NN=C3C=C2)CC |
Computed by PubChem (NCBI)