CAS 864922-20-3 is the registry number for Methyl 4-hydroxy-2-(hydroxymethyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-hydroxy-2-(hydroxymethyl)benzoate (CAS 864922-20-3) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: methyl 4-hydroxy-2-(hydroxymethyl)benzoate. InChIKey: DBOPTFOGYMGRDP-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | methyl 4-hydroxy-2-(hydroxymethyl)benzoate |
| InChIKey | DBOPTFOGYMGRDP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)O)CO |
Computed by PubChem (NCBI)