CAS 866018-46-4 appears in our catalog under these names: 4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-ol 90%, Sertraline Impurity 1 (Mixture of Diastereomers), Sertraline Impurity 16, Sertraline Hydrochloride Impurity H, rac-Cis-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenol. Offered by: Ambeed, Chemat Brand, Biosynth, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, on request.
4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 866018-46-4) is a chemical compound with the molecular formula C16H14Cl2O and a molecular weight of 293.2 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: GZQAUCBRPSENQB-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2O |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | GZQAUCBRPSENQB-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1C3=CC(=C(C=C3)Cl)Cl)O |
Computed by PubChem (NCBI)