CAS 99725-28-7 is the registry number for 3-(2-Benzyl-4,6-dichlorophenyl)propanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-benzyl-4,6-dichlorophenyl)propanal (CAS 99725-28-7) is a chemical compound with the molecular formula C16H14Cl2O and a molecular weight of 293.2 g/mol. IUPAC name: 3-(2-benzyl-4,6-dichlorophenyl)propanal. InChIKey: VSTWJULEQCHNPW-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2O |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 3-(2-benzyl-4,6-dichlorophenyl)propanal |
| InChIKey | VSTWJULEQCHNPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C(=CC(=C2)Cl)Cl)CCC=O |
Computed by PubChem (NCBI)