Products 866144-51-6

CAS 866144-51-6 is the registry number for 4-Methyl-3-(1-oxo-2,3-dihydro-1h-isoindol-2-yl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-methyl-3-(3-oxo-1H-isoindol-2-yl)pentanoic acid (CAS 866144-51-6) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 4-methyl-3-(3-oxo-1H-isoindol-2-yl)pentanoic acid. InChIKey: YGLGUPAEFIXUOO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO3
Molecular weight247.29 g/mol
IUPAC name4-methyl-3-(3-oxo-1H-isoindol-2-yl)pentanoic acid
InChIKeyYGLGUPAEFIXUOO-UHFFFAOYSA-N
SMILESCC(C)C(CC(=O)O)N1CC2=CC=CC=C2C1=O

Computed by PubChem (NCBI)