CAS 866208-24-4 appears in our catalog under these names: 7-Fluoro-3,3-dimethylindolin-2-one, 97%, 7-Fluoro-3,3-dimethyl-2,3-dihydro-1H-indol-2-one, 96%, 96%, 7-Fluoro-3,3-dimethyl-2,3-dihydro-1H-indol-2-one, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
7-fluoro-3,3-dimethyl-1H-indol-2-one (CAS 866208-24-4) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 7-fluoro-3,3-dimethyl-1H-indol-2-one. InChIKey: SPKDBPUOKLXGPF-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 7-fluoro-3,3-dimethyl-1H-indol-2-one |
| InChIKey | SPKDBPUOKLXGPF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC=C2)F)NC1=O)C |
Computed by PubChem (NCBI)