Products 866209-99-6
CAS 866209-99-6 is the registry number for 5-Fluoro-3,3-dimethylindolin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-fluoro-3,3-dimethyl-1H-indol-2-one (CAS 866209-99-6) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 5-fluoro-3,3-dimethyl-1H-indol-2-one. InChIKey: ODQPSSNQVNVDRZ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 5-fluoro-3,3-dimethyl-1H-indol-2-one |
| InChIKey | ODQPSSNQVNVDRZ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)F)NC1=O)C |
Computed by PubChem (NCBI)