CAS 866211-45-2 appears in our catalog under these names: 6-Fluoro-3,3-dimethylindolin-2-one, 6-Fluoro-3,3-dimethylindolin-2-one, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
6-fluoro-3,3-dimethyl-1H-indol-2-one (CAS 866211-45-2) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 6-fluoro-3,3-dimethyl-1H-indol-2-one. InChIKey: PYIOIVVNDDWUBF-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 6-fluoro-3,3-dimethyl-1H-indol-2-one |
| InChIKey | PYIOIVVNDDWUBF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)F)NC1=O)C |
Computed by PubChem (NCBI)