CAS 866211-50-9 is the registry number for 4-Fluoro-3,3-dimethylindolin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-fluoro-3,3-dimethyl-1H-indol-2-one (CAS 866211-50-9) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 4-fluoro-3,3-dimethyl-1H-indol-2-one. InChIKey: TZNVQQZZBGDKSK-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 4-fluoro-3,3-dimethyl-1H-indol-2-one |
| InChIKey | TZNVQQZZBGDKSK-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC=C2F)NC1=O)C |
Computed by PubChem (NCBI)