Products 866402-29-1

CAS 866402-29-1 is the registry number for 4-(2-Ethoxy-2-oxoethylidene)cyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-ethoxy-2-oxoethylidene)cyclohexane-1-carboxylic acid (CAS 866402-29-1) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: 4-(2-ethoxy-2-oxoethylidene)cyclohexane-1-carboxylic acid. InChIKey: MMCDZLFBJGBEFO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16O4
Molecular weight212.24 g/mol
IUPAC name4-(2-ethoxy-2-oxoethylidene)cyclohexane-1-carboxylic acid
InChIKeyMMCDZLFBJGBEFO-UHFFFAOYSA-N
SMILESCCOC(=O)C=C1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)