Products 866474-47-7
CAS 866474-47-7 is the registry number for Ethyl 2-(6-oxo-5-(trifluoromethyl)-1,6-dihydropyridazin-3-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[6-oxo-5-(trifluoromethyl)-1H-pyridazin-3-yl]acetate (CAS 866474-47-7) is a chemical compound with the molecular formula C9H9F3N2O3 and a molecular weight of 250.17 g/mol. IUPAC name: ethyl 2-[6-oxo-5-(trifluoromethyl)-1H-pyridazin-3-yl]acetate. InChIKey: CSHDPBAMNAAWOO-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O3 |
|---|---|
| Molecular weight | 250.17 g/mol |
| IUPAC name | ethyl 2-[6-oxo-5-(trifluoromethyl)-1H-pyridazin-3-yl]acetate |
| InChIKey | CSHDPBAMNAAWOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NNC(=O)C(=C1)C(F)(F)F |
Computed by PubChem (NCBI)