CAS 953882-05-8 is the registry number for 5-(2-Hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(2-hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (CAS 953882-05-8) is a chemical compound with the molecular formula C9H9F3N2O3 and a molecular weight of 250.17 g/mol. IUPAC name: 5-(2-hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide. InChIKey: XYBWJTDIJLKHFE-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O3 |
|---|---|
| Molecular weight | 250.17 g/mol |
| IUPAC name | 5-(2-hydroxyethyl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| InChIKey | XYBWJTDIJLKHFE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1CCO)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)