Products 867329-87-1
CAS 867329-87-1 appears in our catalog under these names: 3-[4-(Diethylsulfamoyl)phenyl]propanoic acid, 95%, 3-(4-(N,N-Diethylsulfamoyl)phenyl)propanoic acid, 97%, 3-(4-(Diethylsulfamoyl)phenyl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 0,5g.
3-[4-(diethylsulfamoyl)phenyl]propanoic acid (CAS 867329-87-1) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: 3-[4-(diethylsulfamoyl)phenyl]propanoic acid. InChIKey: UJPDUPAQLUGRTG-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | 3-[4-(diethylsulfamoyl)phenyl]propanoic acid |
| InChIKey | UJPDUPAQLUGRTG-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)