CAS 867330-72-1 is the registry number for 7-(2-Chloro-5-methoxyphenyl)-5-methyl-1,2,4-benzotriazin-3-amine. Offered by: TRC. Available pack sizes: 500mg.
7-(2-chloro-5-methoxyphenyl)-5-methyl-1,2,4-benzotriazin-3-amine (CAS 867330-72-1) is a chemical compound with the molecular formula C15H13ClN4O and a molecular weight of 300.74 g/mol. IUPAC name: 7-(2-chloro-5-methoxyphenyl)-5-methyl-1,2,4-benzotriazin-3-amine. InChIKey: JFPQJONXEVRXFI-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4O |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 7-(2-chloro-5-methoxyphenyl)-5-methyl-1,2,4-benzotriazin-3-amine |
| InChIKey | JFPQJONXEVRXFI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(N=N2)N)C3=C(C=CC(=C3)OC)Cl |
Computed by PubChem (NCBI)