Products 1206970-30-0
CAS 1206970-30-0 is the registry number for 4-(2-Chloropyrimidin-4-yl)-2-morpholinobenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(2-chloropyrimidin-4-yl)-2-morpholin-4-ylbenzonitrile (CAS 1206970-30-0) is a chemical compound with the molecular formula C15H13ClN4O and a molecular weight of 300.74 g/mol. IUPAC name: 4-(2-chloropyrimidin-4-yl)-2-morpholin-4-ylbenzonitrile. InChIKey: NRFLVUANIKTDGL-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4O |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | 4-(2-chloropyrimidin-4-yl)-2-morpholin-4-ylbenzonitrile |
| InChIKey | NRFLVUANIKTDGL-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=CC(=C2)C3=NC(=NC=C3)Cl)C#N |
Computed by PubChem (NCBI)