CAS 867338-56-5 is the registry number for 2-Amino-5-bromo-3-nitrophenol, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-amino-5-bromo-3-nitrophenol (CAS 867338-56-5) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: 2-amino-5-bromo-3-nitrophenol. InChIKey: XMJNQKQINSXSHA-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O3 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 2-amino-5-bromo-3-nitrophenol |
| InChIKey | XMJNQKQINSXSHA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)O)Br |
Computed by PubChem (NCBI)