CAS 867381-22-4 is the registry number for (5-Chlorobenzo[b]thiophen-2-yl)boronic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g.
(5-chloro-1-benzothiophen-2-yl)boronic acid (CAS 867381-22-4) is a chemical compound with the molecular formula C8H6BClO2S and a molecular weight of 212.46 g/mol. IUPAC name: (5-chloro-1-benzothiophen-2-yl)boronic acid. InChIKey: YNTMDEYDNLWCLF-UHFFFAOYSA-N.
| Molecular formula | C8H6BClO2S |
|---|---|
| Molecular weight | 212.46 g/mol |
| IUPAC name | (5-chloro-1-benzothiophen-2-yl)boronic acid |
| InChIKey | YNTMDEYDNLWCLF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(S1)C=CC(=C2)Cl)(O)O |
Computed by PubChem (NCBI)