CAS 936902-06-6 appears in our catalog under these names: (7-Chlorobenzo(b)thiophen-2-yl)boronic acid, 95-<97%, (7-Chlorobenzo(b)thiophen-2-yl)boronic acid, ≥97-<99%, (7-Chlorobenzo(B)thiophen-2-yl)boronic Acid, (7-Chlorobenzo(b)thiophen-2-yl)boronic acid, 97%, (7-Chloro-1-benzothiophen-2-yl)boronic acid. Offered by: Hoffman Fine Chemicals, TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2,5g, 5g, 0,5g, 50mg.
(7-chloro-1-benzothiophen-2-yl)boronic acid (CAS 936902-06-6) is a chemical compound with the molecular formula C8H6BClO2S and a molecular weight of 212.46 g/mol. IUPAC name: (7-chloro-1-benzothiophen-2-yl)boronic acid. InChIKey: MCBCDJNNKDMHKL-UHFFFAOYSA-N.
| Molecular formula | C8H6BClO2S |
|---|---|
| Molecular weight | 212.46 g/mol |
| IUPAC name | (7-chloro-1-benzothiophen-2-yl)boronic acid |
| InChIKey | MCBCDJNNKDMHKL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(S1)C(=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)