Products 868066-64-2
CAS 868066-64-2 is the registry number for 3-(4-Bromophenyl)-n,n-dimethylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-bromophenyl)-N,N-dimethylpropanamide (CAS 868066-64-2) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 3-(4-bromophenyl)-N,N-dimethylpropanamide. InChIKey: XFNZXGQVUWTWOQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 3-(4-bromophenyl)-N,N-dimethylpropanamide |
| InChIKey | XFNZXGQVUWTWOQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CCC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)