CAS 86847-59-8 appears in our catalog under these names: 2–(Pivaloylamino)pyridine, N-(2-Pyridyl)pivalamide, >98.0%(GC), 2-Pivalamidopyridine 98%, 2,2-Dimethyl-N-pyridin-2-yl-propionamide, 98%, 98%, 2,2-Dimethyl-N-pyridin-2-yl-propionamide, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 100g, 500g, 1g.
2,2-dimethyl-N-pyridin-2-ylpropanamide (CAS 86847-59-8) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 2,2-dimethyl-N-pyridin-2-ylpropanamide. InChIKey: CGSPVYCZBDFPHJ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2,2-dimethyl-N-pyridin-2-ylpropanamide |
| InChIKey | CGSPVYCZBDFPHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=CC=N1 |
Computed by PubChem (NCBI)