Products 868562-26-9
CAS 868562-26-9 appears in our catalog under these names: 3,4-Dimethoxy-2-methylcinnamic acid, 95%, 3,4-Dimethoxy-2-methylcinnamic acid, 3,4-Dimethoxy-2-methylcinnamic acid, min. 95 %, 250 mg, 3,4-Dimethoxy-2-methylcinnamic acid, min. 95 %, 500 mg, 3,4-Dimethoxy-2-methylcinnamic acid, min. 95 %, 1 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 250mg, 1g, 1000mg, 500mg.
(E)-3-(3,4-dimethoxy-2-methylphenyl)prop-2-enoic acid (CAS 868562-26-9) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (E)-3-(3,4-dimethoxy-2-methylphenyl)prop-2-enoic acid. InChIKey: RCSXTTALKLGEPI-FNORWQNLSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxy-2-methylphenyl)prop-2-enoic acid |
| InChIKey | RCSXTTALKLGEPI-FNORWQNLSA-N |
| SMILES | CC1=C(C=CC(=C1OC)OC)/C=C/C(=O)O |
Computed by PubChem (NCBI)