CAS 86891-15-8 is the registry number for 6-Allyldihydronorisolysergic Acid. Offered by: TRC. Available pack sizes: 0,5mg, 5mg.
(6aR,9S)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid (CAS 86891-15-8) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: (6aR,9S)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid. InChIKey: YAICYXFUKKMAKO-RAAOQPIXSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | (6aR,9S)-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid |
| InChIKey | YAICYXFUKKMAKO-RAAOQPIXSA-N |
| SMILES | C=CCN1C[C@H](CC2[C@H]1CC3=CNC4=CC=CC2=C34)C(=O)O |
Computed by PubChem (NCBI)