CAS 869089-95-2 appears in our catalog under these names: (S)-O-(1-Phenylethyl)hydroxylamine hydrochloride, 95+%, o-((1S)-1-Phenylethyl)hydroxylamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
O-[(1S)-1-phenylethyl]hydroxylamine;hydrochloride (CAS 869089-95-2) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. IUPAC name: O-[(1S)-1-phenylethyl]hydroxylamine;hydrochloride. InChIKey: MFJWCIKWSBBOOV-FJXQXJEOSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 173.64 g/mol |
| IUPAC name | O-[(1S)-1-phenylethyl]hydroxylamine;hydrochloride |
| InChIKey | MFJWCIKWSBBOOV-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)ON.Cl |
Computed by PubChem (NCBI)