Products 869333-32-4
CAS 869333-32-4 is the registry number for Ethyl 6-amino-3-chloro-2-fluorobenzoate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Ethyl 6-amino-3-chloro-2-fluorobenzoate (CAS 869333-32-4) is a chemical compound with the molecular formula C9H9ClFNO2 and a molecular weight of 217.62 g/mol. IUPAC name: ethyl 6-amino-3-chloro-2-fluorobenzoate. InChIKey: STWFBABSCHFLDN-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO2 |
|---|---|
| Molecular weight | 217.62 g/mol |
| IUPAC name | ethyl 6-amino-3-chloro-2-fluorobenzoate |
| InChIKey | STWFBABSCHFLDN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)Cl)N |
Computed by PubChem (NCBI)
Synonyms:
ethyl 6-amino-3-chloro-2-fluorobenzoate