CAS 869478-10-4 appears in our catalog under these names: Olodaterol Impurity 6, Olodaterol Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
8-(2-chloroacetyl)-6-phenylmethoxy-4H-1,4-benzoxazin-3-one (CAS 869478-10-4) is a chemical compound with the molecular formula C17H14ClNO4 and a molecular weight of 331.7 g/mol. IUPAC name: 8-(2-chloroacetyl)-6-phenylmethoxy-4H-1,4-benzoxazin-3-one. InChIKey: MNBYEYMYIRMHCK-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO4 |
|---|---|
| Molecular weight | 331.7 g/mol |
| IUPAC name | 8-(2-chloroacetyl)-6-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | MNBYEYMYIRMHCK-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=CC(=C2O1)C(=O)CCl)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)