CAS 903870-82-6 appears in our catalog under these names: 3-(5-Acetyl-2-methoxybenzyl)-5-chloro-1,3-benzoxazol-2(3h)-one, 95%, 3-(5-Acetyl-2-methoxybenzyl)-5-chlorobenzo(d)oxazol-2(3H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-[(5-acetyl-2-methoxyphenyl)methyl]-5-chloro-1,3-benzoxazol-2-one (CAS 903870-82-6) is a chemical compound with the molecular formula C17H14ClNO4 and a molecular weight of 331.7 g/mol. IUPAC name: 3-[(5-acetyl-2-methoxyphenyl)methyl]-5-chloro-1,3-benzoxazol-2-one. InChIKey: VNPQLJTUMGWBJF-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO4 |
|---|---|
| Molecular weight | 331.7 g/mol |
| IUPAC name | 3-[(5-acetyl-2-methoxyphenyl)methyl]-5-chloro-1,3-benzoxazol-2-one |
| InChIKey | VNPQLJTUMGWBJF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)CN2C3=C(C=CC(=C3)Cl)OC2=O |
Computed by PubChem (NCBI)