CAS 86963-40-8 is the registry number for (R)-1-Phenylethanesulfonic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
1-phenylethanesulfonic acid (CAS 86963-40-8) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. IUPAC name: 1-phenylethanesulfonic acid. InChIKey: COFMBBYARPOGBA-UHFFFAOYSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | 1-phenylethanesulfonic acid |
| InChIKey | COFMBBYARPOGBA-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)