CAS 869716-02-9 appears in our catalog under these names: 2-(2-(4-Fluorophenyl)-1,3-thiazol-4-yl)acetohydrazide, 95%, 2-(2-(4-Fluorophenyl)-1,3-thiazol-4-yl)acetohydrazide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetohydrazide (CAS 869716-02-9) is a chemical compound with the molecular formula C11H10FN3OS and a molecular weight of 251.28 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetohydrazide. InChIKey: RDHDVMLJEUVJHV-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3OS |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetohydrazide |
| InChIKey | RDHDVMLJEUVJHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CC(=O)NN)F |
Computed by PubChem (NCBI)