CAS 878259-58-6 appears in our catalog under these names: N-(2-(2-Amino-1,3-thiazol-4-yl)-5-fluorophenyl)acetamide, 95%, N-(2-(2-Amino-1,3-thiazol-4-yl)-5-fluorophenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-[2-(2-amino-1,3-thiazol-4-yl)-5-fluorophenyl]acetamide (CAS 878259-58-6) is a chemical compound with the molecular formula C11H10FN3OS and a molecular weight of 251.28 g/mol. IUPAC name: N-[2-(2-amino-1,3-thiazol-4-yl)-5-fluorophenyl]acetamide. InChIKey: RJCCNZHVIHXOHN-UHFFFAOYSA-N.
| Molecular formula | C11H10FN3OS |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | N-[2-(2-amino-1,3-thiazol-4-yl)-5-fluorophenyl]acetamide |
| InChIKey | RJCCNZHVIHXOHN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)F)C2=CSC(=N2)N |
Computed by PubChem (NCBI)