Products 870243-94-0
CAS 870243-94-0 is the registry number for (4-Bromothieno[2,3-c]pyridin-2-yl)methanol, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(4-bromothieno[2,3-c]pyridin-2-yl)methanol (CAS 870243-94-0) is a chemical compound with the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. IUPAC name: (4-bromothieno[2,3-c]pyridin-2-yl)methanol. InChIKey: KDASDVVLOLIUDT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (4-bromothieno[2,3-c]pyridin-2-yl)methanol |
| InChIKey | KDASDVVLOLIUDT-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=CN=CC(=C21)Br)CO |
Computed by PubChem (NCBI)