CAS 870281-74-6 appears in our catalog under these names: Idelalisib Impurity 3, Desfluoro Idelalisib. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one (CAS 870281-74-6) is a chemical compound with the molecular formula C22H19N7O and a molecular weight of 397.4 g/mol. IUPAC name: 3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one. InChIKey: ROIASNIEFPZNJL-INIZCTEOSA-N.
| Molecular formula | C22H19N7O |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 3-phenyl-2-[(1S)-1-(7H-purin-6-ylamino)propyl]quinazolin-4-one |
| InChIKey | ROIASNIEFPZNJL-INIZCTEOSA-N |
| SMILES | CC[C@@H](C1=NC2=CC=CC=C2C(=O)N1C3=CC=CC=C3)NC4=NC=NC5=C4NC=N5 |
Computed by PubChem (NCBI)