Products 900185-01-5
CAS 900185-01-5 appears in our catalog under these names: PIK–293, PIK-293, PIK-293/ 99.8% (existing batch purity), PIK-293, 97%, 97%, PIK-293, 99.41%. Offered by: GLPBio, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 250mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg.
2-[(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one (CAS 900185-01-5) is a chemical compound with the molecular formula C22H19N7O and a molecular weight of 397.4 g/mol. IUPAC name: 2-[(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one. InChIKey: KQDBVHKNIYROHU-UHFFFAOYSA-N.
| Molecular formula | C22H19N7O |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 2-[(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| InChIKey | KQDBVHKNIYROHU-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)N=C(N(C2=O)C3=CC=CC=C3C)CN4C5=NC=NC(=C5C=N4)N |
Computed by PubChem (NCBI)