CAS 870693-17-7 is the registry number for Ethyl 3-amino-5-(3,4,5-trimethoxyphenyl)thiophene-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Ethyl 3-amino-5-(3,4,5-trimethoxyphenyl)thiophene-2-carboxylate (CAS 870693-17-7) is a chemical compound with the molecular formula C16H19NO5S and a molecular weight of 337.4 g/mol. IUPAC name: ethyl 3-amino-5-(3,4,5-trimethoxyphenyl)thiophene-2-carboxylate. InChIKey: AOPFUZIPWPLVII-UHFFFAOYSA-N.
| Molecular formula | C16H19NO5S |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | ethyl 3-amino-5-(3,4,5-trimethoxyphenyl)thiophene-2-carboxylate |
| InChIKey | AOPFUZIPWPLVII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(S1)C2=CC(=C(C(=C2)OC)OC)OC)N |
Computed by PubChem (NCBI)