Products 874462-68-7
CAS 874462-68-7 appears in our catalog under these names: Glycine Benzyl Ester-13C2,15N p-Toluenesulfonate, >95% (HPLC), H-Gly-OBzl.TosOH-13C2,15N. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
Benzyl 2-(15N)azanylacetate;4-methylbenzenesulfonic acid (CAS 874462-68-7) is a chemical compound with the molecular formula C16H19NO5S and a molecular weight of 340.37 g/mol. IUPAC name: benzyl 2-(15N)azanylacetate;4-methylbenzenesulfonic acid. InChIKey: WJKJXKRHMUXQSL-GMPMXYEBSA-N.
| Molecular formula | C16H19NO5S |
|---|---|
| Molecular weight | 340.37 g/mol |
| IUPAC name | benzyl 2-(15N)azanylacetate;4-methylbenzenesulfonic acid |
| InChIKey | WJKJXKRHMUXQSL-GMPMXYEBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)CO[13C](=O)[13CH2][15NH2] |
Computed by PubChem (NCBI)