CAS 870787-06-7 appears in our catalog under these names: 3-(Trifluoromethyl)pyrazine-2-carboxylic Acid, 3-(Trifluoromethyl)pyrazine-2-carboxylic acid, 97%, 97%, 3-(Trifluoromethyl)pyrazine-2-carboxylic acid, 98%, 3-(Trifluoromethyl)pyrazine-2-carboxylic acid, 97%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
3-(trifluoromethyl)pyrazine-2-carboxylic acid (CAS 870787-06-7) is a chemical compound with the molecular formula C6H3F3N2O2 and a molecular weight of 192.10 g/mol. IUPAC name: 3-(trifluoromethyl)pyrazine-2-carboxylic acid. InChIKey: ZHOIMHWVXJSOBX-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O2 |
|---|---|
| Molecular weight | 192.10 g/mol |
| IUPAC name | 3-(trifluoromethyl)pyrazine-2-carboxylic acid |
| InChIKey | ZHOIMHWVXJSOBX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)