CAS 882068-89-5 appears in our catalog under these names: 2-Nitro-3,4,5-trifluoroaniline, 98%, 3,4,5-TRIFLUORO-2-NITROANILINE, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
3,4,5-trifluoro-2-nitroaniline (CAS 882068-89-5) is a chemical compound with the molecular formula C6H3F3N2O2 and a molecular weight of 192.10 g/mol. IUPAC name: 3,4,5-trifluoro-2-nitroaniline. InChIKey: AZHUGULFZXJYAR-UHFFFAOYSA-N.
| Molecular formula | C6H3F3N2O2 |
|---|---|
| Molecular weight | 192.10 g/mol |
| IUPAC name | 3,4,5-trifluoro-2-nitroaniline |
| InChIKey | AZHUGULFZXJYAR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)