CAS 870888-46-3 appears in our catalog under these names: AC-262536, 95%, AC-262536/ 99.38% (existing batch purity), AC–262536, 4-(3-endo-Hydroxy-8-azabicyclo[3.2.1]oct-8-yl)naphthalene-1-carbonitrile, AC-262536, 99.94%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso).
4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]naphthalene-1-carbonitrile (CAS 870888-46-3) is a chemical compound with the molecular formula C18H18N2O and a molecular weight of 278.3 g/mol. IUPAC name: 4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]naphthalene-1-carbonitrile. InChIKey: ATKWLNSCJYLXPF-YIONKMFJSA-N.
| Molecular formula | C18H18N2O |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 4-[(1R,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]naphthalene-1-carbonitrile |
| InChIKey | ATKWLNSCJYLXPF-YIONKMFJSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2C3=CC=C(C4=CC=CC=C43)C#N)O |
Computed by PubChem (NCBI)