CAS 871507-67-4 is the registry number for (OC-6-21)-(3-(Pentafluoro-l6-sulfaneyl)phenyl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[3-(pentafluoro-lambda6-sulfanyl)phenyl]boronic acid (CAS 871507-67-4) is a chemical compound with the molecular formula C6H6BF5O2S and a molecular weight of 247.98 g/mol. IUPAC name: [3-(pentafluoro-lambda6-sulfanyl)phenyl]boronic acid. InChIKey: HXWXZNLETFLFCX-UHFFFAOYSA-N.
| Molecular formula | C6H6BF5O2S |
|---|---|
| Molecular weight | 247.98 g/mol |
| IUPAC name | [3-(pentafluoro-lambda6-sulfanyl)phenyl]boronic acid |
| InChIKey | HXWXZNLETFLFCX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(F)(F)(F)(F)F)(O)O |
Computed by PubChem (NCBI)