CAS 871507-70-9 appears in our catalog under these names: (OC-6-21)-4-Pentafluorosulfanylphenylboronic acid, 95%, 4-Pentafluorosulfanylphenylboronic acid, 90%, 90%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
[4-(pentafluoro-lambda6-sulfanyl)phenyl]boronic acid (CAS 871507-70-9) is a chemical compound with the molecular formula C6H6BF5O2S and a molecular weight of 247.98 g/mol. IUPAC name: [4-(pentafluoro-lambda6-sulfanyl)phenyl]boronic acid. InChIKey: FCJOBVXWUWODSK-UHFFFAOYSA-N.
| Molecular formula | C6H6BF5O2S |
|---|---|
| Molecular weight | 247.98 g/mol |
| IUPAC name | [4-(pentafluoro-lambda6-sulfanyl)phenyl]boronic acid |
| InChIKey | FCJOBVXWUWODSK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(F)(F)(F)(F)F)(O)O |
Computed by PubChem (NCBI)