Products 87156-00-1
CAS 87156-00-1 is the registry number for EDA-DA. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-[[(2R)-2-aminopent-4-ynoyl]amino]propanoic acid (CAS 87156-00-1) is a chemical compound with the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. IUPAC name: (2R)-2-[[(2R)-2-aminopent-4-ynoyl]amino]propanoic acid. InChIKey: XAJDRUDXNXZVCE-PHDIDXHHSA-N.
| Molecular formula | C8H12N2O3 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-aminopent-4-ynoyl]amino]propanoic acid |
| InChIKey | XAJDRUDXNXZVCE-PHDIDXHHSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)[C@@H](CC#C)N |
Computed by PubChem (NCBI)