CAS 872018-41-2 is the registry number for 6-Bromo-3-methylisoquinolin-1-amine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-3-methylisoquinolin-1-amine (CAS 872018-41-2) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 6-bromo-3-methylisoquinolin-1-amine. InChIKey: UGSOVMNWHPNVEB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 6-bromo-3-methylisoquinolin-1-amine |
| InChIKey | UGSOVMNWHPNVEB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)Br)C(=N1)N |
Computed by PubChem (NCBI)