Products 872091-99-1
CAS 872091-99-1 is the registry number for 5-(2-Cyanopropan-2-yl)thiophene-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 25mg.
5-(2-cyanopropan-2-yl)thiophene-3-carboxylic acid (CAS 872091-99-1) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 5-(2-cyanopropan-2-yl)thiophene-3-carboxylic acid. InChIKey: QCPIGVXMSVRBKO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 5-(2-cyanopropan-2-yl)thiophene-3-carboxylic acid |
| InChIKey | QCPIGVXMSVRBKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC(=CS1)C(=O)O |
Computed by PubChem (NCBI)