Products 872122-36-6
CAS 872122-36-6 is the registry number for MRZ-8676. Offered by: MedChemExpress. Available pack sizes: Get quote.
6,6-dimethyl-2-(2-phenylethynyl)-7,8-dihydroquinolin-5-one (CAS 872122-36-6) is a chemical compound with the molecular formula C19H17NO and a molecular weight of 275.3 g/mol. IUPAC name: 6,6-dimethyl-2-(2-phenylethynyl)-7,8-dihydroquinolin-5-one. InChIKey: GXHZJFOEDFUGMK-UHFFFAOYSA-N.
| Molecular formula | C19H17NO |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 6,6-dimethyl-2-(2-phenylethynyl)-7,8-dihydroquinolin-5-one |
| InChIKey | GXHZJFOEDFUGMK-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1=O)C=CC(=N2)C#CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)