Products 87237-39-6
CAS 87237-39-6 is the registry number for H-D-Tyr-Val-NH2. Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanamide (CAS 87237-39-6) is a chemical compound with the molecular formula C14H21N3O3 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanamide. InChIKey: KETVITBYSZOWFK-RYUDHWBXSA-N.
| Molecular formula | C14H21N3O3 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanamide |
| InChIKey | KETVITBYSZOWFK-RYUDHWBXSA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)[C@H](CC1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)