Products 87254-91-9

CAS 87254-91-9 is the registry number for S-Methyl Tiopronin. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.

Structural formula: {0} (CAS {1})

2-(2-methylsulfanylpropanoylamino)acetic acid (CAS 87254-91-9) is a chemical compound with the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. IUPAC name: 2-(2-methylsulfanylpropanoylamino)acetic acid. InChIKey: MYXILMBGSNHKTB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11NO3S
Molecular weight177.22 g/mol
IUPAC name2-(2-methylsulfanylpropanoylamino)acetic acid
InChIKeyMYXILMBGSNHKTB-UHFFFAOYSA-N
SMILESCC(C(=O)NCC(=O)O)SC

Computed by PubChem (NCBI)